Compound Q&A

What are the main uses of Tridecanedioic acid (CAS: 505-52-2)?

Answer

Tridecanedioic acid
Tridecanedioic acid (CAS: 505-52-2) is primarily used in the pharmaceutical industry as a precursor for drug development and in polymer chemistry for creating polyamides and polyesters. It also serves as a research reagent for studying lipid metabolism and is applied in industrial processes for coatings, lubricants, and surfactant formulations. Additionally, it may be used as a flavoring agent in food additives, though its primary focus remains in chemical and pharmaceutical applications.

About

CAS No 505-52-2
English Name Tridecanedioic acid
Molecular Formula C13H24O4
Molecular Weight 244.33 g/mol
SMILES C(CCCCCC(=O)O)CCCCCC(=O)O
InChIKey DXNCZXXFRKPEPY-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Tridecanedioic acid (CAS: 505-52-2)?

Tridecanedioic acid (CAS: 505-52-2) is a long-chain dicarboxylic acid with the chemical formula C13H...

Compound Q&A

Is Tridecanedioic acid (CAS: 505-52-2) safe?

Tridecanedioic acid (CAS: 505-52-2) is generally considered low toxicity when handled properly, but ...

Compound Q&A

How should Tridecanedioic acid (CAS: 505-52-2) be stored?

Tridecanedioic acid (CAS: 505-52-2) should be stored in a sealed, airtight container in a cool (20–2...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...