Compound Q&A

What are the main uses of (R)-2-((2S,3S)-3-((R)-1-((tert-Butyldimethylsilyl)oxy)ethyl)-4-oxoazetidin-2-yl)propanoic acid (CAS: 90776-58-2)?

Answer

(R)-2-((2S,3S)-3-((R)-1-((tert-Butyldimethylsilyl)oxy)ethyl)-4-oxoazetidin-2-yl)propanoic acid
This compound is primarily used as an intermediate in pharmaceutical research, particularly in the synthesis of bioactive molecules. Its unique structure, including the silyl ether group, makes it valuable for protecting functional groups during complex organic reactions. It also finds applications in medicinal chemistry and specialty chemical manufacturing.

About

CAS No 90776-58-2
English Name (R)-2-((2S,3S)-3-((R)-1-((tert-Butyldimethylsilyl)oxy)ethyl)-4-oxoazetidin-2-yl)propanoic acid
Molecular Formula C14H27NO4Si
Molecular Weight 301.46 g/mol
SMILES CC(C1C(NC1=O)C(C)C(=O)O)O[Si](C)(C)C(C)(C)C
InChIKey NNANGMFTFSNDLW-GWOFURMSSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (R)-2-((2S,3S)-3-((R)-1-((tert-Butyldimethylsilyl)oxy)ethyl)-4-oxoazetidin-2-yl)propanoic acid (CAS: 90776-58-2)?

This compound is a complex organic molecule featuring a propanoic acid group linked to a 4-oxoazetid...

Compound Q&A

Is (R)-2-((2S,3S)-3-((R)-1-((tert-Butyldimethylsilyl)oxy)ethyl)-4-oxoazetidin-2-yl)propanoic acid (CAS: 90776-58-2) safe?

Safety data for this compound is limited, but standard lab precautions apply. It should be handled w...

Compound Q&A

How should (R)-2-((2S,3S)-3-((R)-1-((tert-Butyldimethylsilyl)oxy)ethyl)-4-oxoazetidin-2-yl)propanoic acid (CAS: 90776-58-2) be stored?

Store in a cool, dry place (2-8°C), away from light and moisture. Use airtight, sealed containers to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...