Compound Q&A

What is (3R,4R,5R)-3,4-Bis(benzyloxy)-5-[(benzyloxy)methyl]dihydro-2(3H)-furanone (CAS: 55094-52-5)?

Answer

(3R,4R,5R)-3,4-Bis(benzyloxy)-5-[(benzyloxy)methyl]dihydro-2(3H)-furanone
This compound, with the CAS number 55094-52-5, is a synthetic organic molecule characterized by its stereochemistry and functional groups. It has the chemical formula C21H22O6 and is known for its complex structure involving multiple benzyloxy groups and a dihydrofuranone ring. It is commonly used in chemical synthesis and research due to its reactivity and potential for forming various derivatives.

About

CAS No 55094-52-5
English Name (3R,4R,5R)-3,4-Bis(benzyloxy)-5-[(benzyloxy)methyl]dihydro-2(3H)-furanone
Molecular Formula C26H26O5
Molecular Weight 418.49 g/mol
SMILES C1=CC=C(C=C1)COCC2C(C(C(=O)O2)OCC3=CC=CC=C3)OCC4=CC=CC=C4
InChIKey LDHBSABBBAUMCZ-UBFVSLLYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (3R,4R,5R)-3,4-Bis(benzyloxy)-5-[(benzyloxy)methyl]dihydro-2(3H)-furanone (CAS: 55094-52-5)?

This compound is primarily used in pharmaceutical research for the development of drug molecules, pa...

Compound Q&A

Is (3R,4R,5R)-3,4-Bis(benzyloxy)-5-[(benzyloxy)methyl]dihydro-2(3H)-furanone (CAS: 55094-52-5) safe?

As a chemical compound, (3R,4R,5R)-3,4-Bis(benzyloxy)-5-[(benzyloxy)methyl]dihydro-2(3H)-furanone (C...

Compound Q&A

How should (3R,4R,5R)-3,4-Bis(benzyloxy)-5-[(benzyloxy)methyl]dihydro-2(3H)-furanone (CAS: 55094-52-5) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is sensitive to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...