Compound Q&A

What are the main uses of 2-(4-Chlorophenoxy)-2-methylpropanoic acid (CAS: 882-09-7)?

Answer

2-(4-Chlorophenoxy)-2-methylpropanoic acid
2-(4-Chlorophenoxy)-2-methylpropanoic acid (CAS: 882-09-7) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in agrochemicals and research for its structural versatility and reactivity. Its use in food is limited, and it is mainly explored for industrial and medicinal purposes.

About

CAS No 882-09-7
English Name 2-(4-Chlorophenoxy)-2-methylpropanoic acid
Molecular Formula C10H11ClO3
Molecular Weight 214.65 g/mol
SMILES CC(C)(Oc1ccc(Cl)cc1)C(=O)O
InChIKey TXCGAZHTZHNUAI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-(4-Chlorophenoxy)-2-methylpropanoic acid (CAS: 882-09-7)?

2-(4-Chlorophenoxy)-2-methylpropanoic acid, with CAS number 882-09-7, is an organic compound that be...

Compound Q&A

Is 2-(4-Chlorophenoxy)-2-methylpropanoic acid (CAS: 882-09-7) safe?

2-(4-Chlorophenoxy)-2-methylpropanoic acid (CAS: 882-09-7) is generally considered safe when handled...

Compound Q&A

How should 2-(4-Chlorophenoxy)-2-methylpropanoic acid (CAS: 882-09-7) be stored?

2-(4-Chlorophenoxy)-2-methylpropanoic acid (CAS: 882-09-7) should be stored in a cool, dry, and well...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...