Compound Q&A

What are the main uses of 4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3)?

Answer

4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid
4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3) is primarily used in pharmaceutical research as a building block for drug development. It also serves in agrochemicals and industrial applications, such as pesticide formulations and polymer synthesis. Its unique structure makes it valuable for creating derivatives with specific biological or chemical properties.

About

CAS No 305-03-3
English Name 4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid
Molecular Formula C14H19Cl2NO2
Molecular Weight 304.22 g/mol
SMILES C1=CC(=CC=C1CCCC(=O)O)N(CCCl)CCCl
InChIKey JCKYGMPEJWAADB-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3)?

4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3) is an organic compound featuring ...

Compound Q&A

Is 4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3) safe?

Safety of 4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3) depends on handling con...

Compound Q&A

How should 4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3) be stored?

4-{4-[Bis(2-chloroethyl)amino]phenyl}butanoic acid (CAS: 305-03-3) should be stored in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...