Compound Q&A

What are the main uses of Phenyl(2-piperidinyl)acetic acid (CAS: 19395-41-6)?

Answer

Phenyl(2-piperidinyl)acetic acid
Phenyl(2-piperidinyl)acetic acid is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in the synthesis of various organic compounds, including those used in agrochemicals and materials science. Its utility stems from the presence of both acetic acid and piperidine functional groups.

About

CAS No 19395-41-6
English Name Phenyl(2-piperidinyl)acetic acid
Molecular Formula C13H17NO2
Molecular Weight 219.28 g/mol
EINECS 243-020-7
SMILES C1CCNC(C1)C(C2=CC=CC=C2)C(=O)O
InChIKey INGSNVSERUZOAK-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Phenyl(2-piperidinyl)acetic acid (CAS: 19395-41-6)?

Phenyl(2-piperidinyl)acetic acid is a chemical compound with the CAS number 19395-41-6. It is a whit...

Compound Q&A

Is Phenyl(2-piperidinyl)acetic acid (CAS: 19395-41-6) safe?

Phenyl(2-piperidinyl)acetic acid is generally considered safe when handled properly. However, it may...

Compound Q&A

How should Phenyl(2-piperidinyl)acetic acid (CAS: 19395-41-6) be stored?

Phenyl(2-piperidinyl)acetic acid should be stored in a cool, dry, and dark place, away from moisture...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...