Compound Q&A

What is 2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 546-56-5)?

Answer

2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane
2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane is a synthetic organic compound with the CAS number 546-56-5. It is a highly branched organosilicon molecule containing multiple phenyl and oxygen groups. The compound is known for its thermal stability and inert nature, making it suitable for specialized chemical applications. It is often used as a precursor in the synthesis of other silicon-based compounds.

About

CAS No 546-56-5
English Name 2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane
Molecular Formula C48H40O4Si4
Molecular Weight 793.19 g/mol
SMILES C1=CC=C(C=C1)[Si]2(O[Si](O[Si](O[Si](O2)(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8)C9=CC=CC=C9
InChIKey VSIKJPJINIDELZ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 546-56-5)?

2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 546-56-5) is primarily used in...

Compound Q&A

Is 2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 546-56-5) safe?

2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 546-56-5) is generally conside...

Compound Q&A

How should 2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 546-56-5) be stored?

2,2,4,4,6,6,8,8-Octaphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 546-56-5) should be stored in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...