Compound Q&A

Is 2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid (CAS: 85-73-4) safe?

Answer

2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid
The safety of 2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid (CAS: 85-73-4) depends on its application and exposure conditions. It is generally considered safe in controlled laboratory settings, but proper handling is required. Protective measures such as gloves and ventilation should be used to minimize risks during experimentation or industrial use.

About

CAS No 85-73-4
English Name 2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid
Molecular Formula C17H13N3O5S2
Molecular Weight 403.44 g/mol
SMILES OC(=O)c1ccccc1C(=O)Nc2ccc(cc2)S(=O)(=O)Nc3nccs3
InChIKey PBMSWVPMRUJMPE-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid (CAS: 85-73-4)?

2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid (CAS: 85-73-4) is a chemical compound...

Compound Q&A

What are the main uses of 2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid (CAS: 85-73-4)?

This compound is primarily used in pharmaceutical research for the development of drugs targeting in...

Compound Q&A

How should 2-{[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]carbamoyl}benzoic acid (CAS: 85-73-4) be stored?

This compound should be stored in a cool, dry place away from direct light. It is best kept in a sea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...