Compound Q&A

How should (4S,6S)-4-(Ethylamino)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide hydrochloride (1:1) (CAS: 130693-82-2) be stored?

Answer

(4S,6S)-4-(Ethylamino)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide hydrochloride (1:1)
This compound should be stored in a cool, dry place at 2-8°C, protected from light and moisture. It requires airtight container storage to maintain stability and prevent degradation. Avoid exposure to humidity and keep it in a sealed, non-reactive container to ensure long-term chemical integrity and safety during handling.

About

English Name (4S,6S)-4-(Ethylamino)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide hydrochloride (1:1)
Molecular Formula C10H17ClN2O4S3
Molecular Weight 360.91 g/mol
SMILES CCNC1CC(S(=O)(=O)C2=C1C=C(S2)S(=O)(=O)N)C.Cl
InChIKey OSRUSFPMRGDLAG-QMGYSKNISA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (4S,6S)-4-(Ethylamino)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide hydrochloride (1:1) (CAS: 130693-82-2)?

This compound is a sulfonamide derivative with a complex chemical structure containing a thieno[2,3-...

Compound Q&A

What are the main uses of (4S,6S)-4-(Ethylamino)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide hydrochloride (1:1) (CAS: 130693-82-2)?

This compound is primarily used in pharmaceutical research as a potential therapeutic agent, particu...

Compound Q&A

Is (4S,6S)-4-(Ethylamino)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide hydrochloride (1:1) (CAS: 130693-82-2) safe?

Safety considerations for this compound include potential toxicity if ingested or inhaled, necessita...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...