Compound Q&A

What are the main uses of 2-{[(E)-{5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethanamine (2Z)-2-butenedioate (1:1) (CAS: 61718-82-9)?

Answer

2-{[(E)-{5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethanamine (2Z)-2-butenedioate (1:1)
This compound is primarily used in pharmaceutical research as an intermediate for drug development, particularly in the synthesis of bioactive molecules. Its unique structure may also find applications in organic chemistry for creating derivatives or in industrial processes requiring functionalized esters. Additionally, it is utilized in chemical research for its potential in catalytic reactions and molecular design, though specific applications depend on further studies.

About

CAS No 61718-82-9
English Name 2-{[(E)-{5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethanamine (2Z)-2-butenedioate (1:1)
Molecular Formula C19H25F3N2O6
Molecular Weight 434.41 g/mol
SMILES COCCCCC(=NOCCN)C1=CC=C(C=C1)C(F)(F)F.C(=CC(=O)O)C(=O)O
InChIKey LFMYNZPAVPMEGP-PIDGMYBPSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-{[(E)-{5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethanamine (2Z)-2-butenedioate (1:1) (CAS: 61718-82-9)?

2-{[(E)-{5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethanamine (2Z)-2-butenedioate...

Compound Q&A

Is 2-{[(E)-{5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethanamine (2Z)-2-butenedioate (1:1) (CAS: 61718-82-9) safe?

Safety of this compound requires careful handling due to its chemical complexity. While specific tox...

Compound Q&A

How should 2-{[(E)-{5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethanamine (2Z)-2-butenedioate (1:1) (CAS: 61718-82-9) be stored?

This compound should be stored in a cool, dry place (ideally 2-8°C), away from light and moisture. K...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...