Compound Q&A

What are the main uses of butane-1,2,3,4-tetracarboxylic acid (CAS: 1703-58-8)?

Answer

butane-1,2,3,4-tetracarboxylic acid
Butane-1,2,3,4-tetracarboxylic acid (CAS 1703-58-8) is primarily used in pharmaceuticals as a building block for drug synthesis. It also serves in industrial applications, such as polymer production and the creation of specialty chemicals. In research, it is employed for organic reactions and the development of functionalized compounds. Its versatility makes it valuable in chemical synthesis and material science.

About

CAS No 1703-58-8
English Name butane-1,2,3,4-tetracarboxylic acid
Molecular Formula C8H10O8
Molecular Weight 234.16 g/mol
SMILES C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O
InChIKey GGAUUQHSCNMCAU-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is butane-1,2,3,4-tetracarboxylic acid (CAS: 1703-58-8)?

Butane-1,2,3,4-tetracarboxylic acid (CAS 1703-58-8) is a tetracarboxylic acid with four carboxylic g...

Compound Q&A

Is butane-1,2,3,4-tetracarboxylic acid (CAS: 1703-58-8) safe?

Butane-1,2,3,4-tetracarboxylic acid (CAS 1703-58-8) is considered hazardous due to its corrosive nat...

Compound Q&A

How should butane-1,2,3,4-tetracarboxylic acid (CAS: 1703-58-8) be stored?

Butane-1,2,3,4-tetracarboxylic acid (CAS 1703-58-8) should be stored in a cool, dry place (2-8°C) in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...