Compound Q&A

What is 2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0)?

Answer

2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol
2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0) is an organic compound with the chemical formula C12H18O. It is a phenol derivative featuring a hydroxyl group on a benzene ring substituted with methyl and 2-methyl-2-propanyl (tert-butyl) groups. The compound is typically a colorless to yellowish solid with a phenolic odor, known for its stability in organic solvents and applications in chemical synthesis.

About

CAS No 1879-09-0
English Name 2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol
Molecular Formula C12H18O
Molecular Weight 178.27 g/mol
SMILES Cc1cc(C)c(O)c(c1)C(C)(C)C
InChIKey OPLCSTZDXXUYDU-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0)?

2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0) is primarily used as a chemical intermed...

Compound Q&A

Is 2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0) safe?

2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0) requires careful handling due to its pot...

Compound Q&A

How should 2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0) be stored?

2,4-Dimethyl-6-(2-methyl-2-propanyl)phenol (CAS: 1879-09-0) should be stored in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...