Compound Q&A

What is (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS: 3371-27-5)?

Answer

(2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol
(2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS 3371-27-5) is a naturally occurring polyphenolic compound. It has the chemical formula C15H14O8 and is known for its antioxidant properties. This compound is a derivative of chromanetriol with hydroxyphenyl groups attached, contributing to its structural complexity and biological activity.

About

CAS No 3371-27-5
English Name (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol
Molecular Formula C15H14O7
Molecular Weight 306.27 g/mol
SMILES Oc1cc2O[C@@H](c3cc(O)c(c(c3)O)O)[C@@H](Cc2c(c1)O)O
InChIKey XMOCLSLCDHWDHP-DOMZBBRYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS: 3371-27-5)?

(2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS 3371-27-5) is primarily used in pharmac...

Compound Q&A

Is (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS: 3371-27-5) safe?

(2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS 3371-27-5) is generally considered safe...

Compound Q&A

How should (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS: 3371-27-5) be stored?

(2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,5,7-chromanetriol (CAS 3371-27-5) should be stored in a cool, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...