Compound Q&A

How should (2Z)-7-{[(2R)-2-Amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)-2-heptenoic acid (CAS: 82009-34-5) be stored?

Answer

(2Z)-7-{[(2R)-2-Amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)-2-heptenoic acid
This compound should be stored in a cool, dry, and dark place to maintain stability. It is recommended to keep it in a tightly sealed container, away from moisture and light exposure. Storage conditions may also require a controlled temperature, typically between 2°C to 8°C, depending on its specific chemical sensitivity. Always follow manufacturer guidelines for optimal storage.

About

CAS No 82009-34-5
English Name (2Z)-7-{[(2R)-2-Amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)-2-heptenoic acid
Molecular Formula C16H26N2O5S
Molecular Weight 358.46 g/mol
SMILES CC1(CC1C(=O)NC(=CCCCCSCC(C(=O)O)N)C(=O)O)C
InChIKey DHSUYTOATWAVLW-WFVMDLQDSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (2Z)-7-{[(2R)-2-Amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)-2-heptenoic acid (CAS: 82009-34-5)?

This compound, with the CAS number 82009-34-5, is a complex organic molecule containing multiple fun...

Compound Q&A

What are the main uses of (2Z)-7-{[(2R)-2-Amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)-2-heptenoic acid (CAS: 82009-34-5)?

The compound is primarily used in pharmaceutical research for its potential biological activity, esp...

Compound Q&A

Is (2Z)-7-{[(2R)-2-Amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)-2-heptenoic acid (CAS: 82009-34-5) safe?

Safety data for this compound is not extensively available, but as with many complex organic chemica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...