Compound Q&A

What are the main uses of (8S,13S,14S)-13-Methyl-1,4,6,7,8,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-3,2'-[1,3]dioxolan]-17(2H)-one (CAS: 5571-36-8)?

Answer

(8S,13S,14S)-13-Methyl-1,4,6,7,8,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-3,2'-[1,3]dioxolan]-17(2H)-one
This compound is primarily used in pharmaceutical research as a potential precursor for drug development, particularly in the synthesis of bioactive molecules. It may also find applications in organic chemistry for studying stereochemistry and ring structures. Its specific uses depend on its functional groups and molecular framework, which are relevant in medicinal chemistry and chemical synthesis.

About

CAS No 5571-36-8
English Name (8S,13S,14S)-13-Methyl-1,4,6,7,8,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-3,2'-[1,3]dioxolan]-17(2H)-one
Molecular Formula C20H26O3
Molecular Weight 314.43 g/mol
SMILES CC12CC=C3C(C1CCC2=O)CCC4=C3CCC5(C4)OCCO5
InChIKey XUOQKQRMICQUQC-AOIWGVFYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (8S,13S,14S)-13-Methyl-1,4,6,7,8,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-3,2'-[1,3]dioxolan]-17(2H)-one (CAS: 5571-36-8)?

This is a complex organic compound with the CAS number 5571-36-8. It features a spiro junction conne...

Compound Q&A

Is (8S,13S,14S)-13-Methyl-1,4,6,7,8,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-3,2'-[1,3]dioxolan]-17(2H)-one (CAS: 5571-36-8) safe?

Safety depends on exposure conditions. While no specific toxicity data is widely publicized, standar...

Compound Q&A

How should (8S,13S,14S)-13-Methyl-1,4,6,7,8,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-3,2'-[1,3]dioxolan]-17(2H)-one (CAS: 5571-36-8) be stored?

Store in a sealed, cool (2-8°C), and dry environment, away from light. Keep in airtight containers t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...