Compound Q&A

What is 2-Amino-5-chloro-3-methylbenzoic acid (CAS: 20776-67-4)?

Answer

2-Amino-5-chloro-3-methylbenzoic acid
2-Amino-5-chloro-3-methylbenzoic acid (CAS: 20776-67-4) is an organic compound containing a benzene ring with amino, chloro, and methyl functional groups. It has the chemical formula C8H9NO2Cl and is typically a white solid at room temperature. The compound exhibits moderate solubility in water and organic solvents and is known for its acidic properties due to the carboxylic acid group.

About

CAS No 20776-67-4
English Name 2-Amino-5-chloro-3-methylbenzoic acid
Molecular Formula C8H8ClNO2
Molecular Weight 185.61 g/mol
SMILES CC1=CC(=CC(=C1N)C(=O)O)Cl
InChIKey KOPXCQUAFDWYOE-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-5-chloro-3-methylbenzoic acid (CAS: 20776-67-4)?

2-Amino-5-chloro-3-methylbenzoic acid is primarily used in pharmaceutical research as a building blo...

Compound Q&A

Is 2-Amino-5-chloro-3-methylbenzoic acid (CAS: 20776-67-4) safe?

2-Amino-5-chloro-3-methylbenzoic acid is generally considered safe when handled properly. However, a...

Compound Q&A

How should 2-Amino-5-chloro-3-methylbenzoic acid (CAS: 20776-67-4) be stored?

2-Amino-5-chloro-3-methylbenzoic acid should be stored in a cool, dry, and well-ventilated place, aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...