Compound Q&A

What is 2,4-Dichloroquinazoline (CAS: 607-68-1)?

Answer

2,4-Dichloroquinazoline
2,4-Dichloroquinazoline (CAS: 607-68-1) is an organic compound with the chemical formula C8H6Cl2N2. It is a derivative of quinazoline, characterized by two chlorine atoms attached to the 2 and 4 positions of the quinazoline ring. This compound is known for its aromatic structure and is used in various chemical applications due to its reactivity and stability.

About

CAS No 607-68-1
English Name 2,4-Dichloroquinazoline
Molecular Formula C8H4Cl2N2
Molecular Weight 199.04 g/mol
SMILES C1=CC=C2C(=C1)C(=NC(=N2)Cl)Cl
InChIKey TUQSVSYUEBNNKQ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2,4-Dichloroquinazoline (CAS: 607-68-1)?

2,4-Dichloroquinazoline (CAS: 607-68-1) is primarily used in pharmaceutical research as a building b...

Compound Q&A

Is 2,4-Dichloroquinazoline (CAS: 607-68-1) safe?

2,4-Dichloroquinazoline (CAS: 607-68-1) is considered hazardous due to its potential toxicity. It sh...

Compound Q&A

How should 2,4-Dichloroquinazoline (CAS: 607-68-1) be stored?

2,4-Dichloroquinazoline (CAS: 607-68-1) should be stored in a cool, dry, and well-ventilated place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...