Compound Q&A

What is 4-Bromodibenzothiophene (CAS: 97511-05-2)?

Answer

4-Bromodibenzothiophene
4-Bromodibenzothiophene is an organic compound with the chemical formula C12H9BrS. It is a brominated derivative of dibenzothiophene, characterized by its aromatic structure and sulfur-containing ring. This compound is commonly used in chemical research and has applications in various synthetic processes due to its reactivity and unique molecular properties.

About

CAS No 97511-05-2
English Name 4-Bromodibenzothiophene
Molecular Formula C12H7BrS
Molecular Weight 263.16 g/mol
SMILES C1=CC=C2C(=C1)C3=C(S2)C(=CC=C3)Br
InChIKey GJXAVNQWIVUQOD-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 4-Bromodibenzothiophene (CAS: 97511-05-2)?

4-Bromodibenzothiophene is primarily used in the synthesis of pharmaceuticals, agrochemicals, and ma...

Compound Q&A

Is 4-Bromodibenzothiophene (CAS: 97511-05-2) safe?

4-Bromodibenzothiophene is considered potentially hazardous due to its chemical nature. It should be...

Compound Q&A

How should 4-Bromodibenzothiophene (CAS: 97511-05-2) be stored?

4-Bromodibenzothiophene should be stored in a cool, dry, and dark place, preferably at 2-8°C. It req...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...