Compound Q&A

What is 1-Chloro-4-nitro-2-(trifluoromethyl)benzene (CAS: 777-37-7)?

Answer

1-Chloro-4-nitro-2-(trifluoromethyl)benzene
1-Chloro-4-nitro-2-(trifluoromethyl)benzene is an aromatic organic compound with the chemical formula C7H4ClNO2F3. It contains a benzene ring substituted with a chlorine atom, a nitro group, and a trifluoromethyl group. This compound is known for its high stability and is commonly used in chemical synthesis due to its versatile functional groups.

About

CAS No 777-37-7
English Name 1-Chloro-4-nitro-2-(trifluoromethyl)benzene
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)Cl
InChIKey HQROXDLWVGFPDE-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1-Chloro-4-nitro-2-(trifluoromethyl)benzene (CAS: 777-37-7)?

1-Chloro-4-nitro-2-(trifluoromethyl)benzene is primarily used in the pharmaceutical industry as an i...

Compound Q&A

Is 1-Chloro-4-nitro-2-(trifluoromethyl)benzene (CAS: 777-37-7) safe?

1-Chloro-4-nitro-2-(trifluoromethyl)benzene is considered hazardous due to its potential to cause sk...

Compound Q&A

How should 1-Chloro-4-nitro-2-(trifluoromethyl)benzene (CAS: 777-37-7) be stored?

1-Chloro-4-nitro-2-(trifluoromethyl)benzene should be stored in a cool, dry, and well-ventilated are...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...