Compound Q&A

What is 16-Dehydropregnenolone acetate (CAS: 979-02-2)?

Answer

16-Dehydropregnenolone acetate
16-Dehydropregnenolone acetate is a steroidal compound with the chemical formula C22H34O3. It is a derivative of pregnenolone and is commonly used in biochemical research. This compound is known for its structural similarity to other steroid hormones and exhibits specific solubility and melting point characteristics, making it suitable for various analytical applications.

About

CAS No 979-02-2
English Name 16-Dehydropregnenolone acetate
Molecular Formula C23H32O3
Molecular Weight 148.19 g/mol
SMILES CC(=O)C1=CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C)C
InChIKey MZWRIOUCMXPLKV-RFOVXIPZSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 16-Dehydropregnenolone acetate (CAS: 979-02-2)?

16-Dehydropregnenolone acetate is primarily used in pharmaceutical research for studying hormone-rel...

Compound Q&A

Is 16-Dehydropregnenolone acetate (CAS: 979-02-2) safe?

16-Dehydropregnenolone acetate is generally considered safe when handled properly. However, as with ...

Compound Q&A

How should 16-Dehydropregnenolone acetate (CAS: 979-02-2) be stored?

16-Dehydropregnenolone acetate should be stored in a cool, dry place away from direct light. It is t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...