Compound Q&A

What are the main uses of (2S)-3-(2-Sulfanyl-1H-imidazol-4-yl)-2-(trimethylammonio)propanoate (CAS: 497-30-3)?

Answer

(2S)-3-(2-Sulfanyl-1H-imidazol-4-yl)-2-(trimethylammonio)propanoate
This compound is primarily used in pharmaceutical research as a ligand or intermediate for drug development, particularly in targeting biological pathways involving metal ions. It also serves as a precursor in the synthesis of bioactive molecules and may find applications in enzyme inhibition studies. Its unique structure makes it relevant in organic chemistry and medicinal chemistry for functional group manipulation and compound design.

About

CAS No 497-30-3
English Name (2S)-3-(2-Sulfanyl-1H-imidazol-4-yl)-2-(trimethylammonio)propanoate
Molecular Formula C9H15N3O2S
Molecular Weight 229.3 g/mol
SMILES [O-]C(=O)[C@@H]([N+](C)(C)C)Cc1c[nH]c(=S)[nH]1
InChIKey SSISHJJTAXXQAX-ZETCQYMHSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (2S)-3-(2-Sulfanyl-1H-imidazol-4-yl)-2-(trimethylammonio)propanoate (CAS: 497-30-3)?

This compound is a zwitterionic organic molecule with the chemical formula C6H12N3O2S. It features a...

Compound Q&A

Is (2S)-3-(2-Sulfanyl-1H-imidazol-4-yl)-2-(trimethylammonio)propanoate (CAS: 497-30-3) safe?

This compound is generally considered safe when handled according to standard chemical safety protoc...

Compound Q&A

How should (2S)-3-(2-Sulfanyl-1H-imidazol-4-yl)-2-(trimethylammonio)propanoate (CAS: 497-30-3) be stored?

Store this compound in a cool, dry place (ideally 20°C), away from light and moisture. Use a sealed,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...