Compound Q&A

What is 2,5-Furandicarboxylic acid (CAS: 3238-40-2)?

Answer

2,5-Furandicarboxylic acid
2,5-Furandicarboxylic acid (CAS: 3238-40-2) is a cyclic dicarboxylic acid with the chemical formula C5H4O4. It features two carboxylic acid groups attached to the 2 and 5 positions of a furan ring, making it a versatile compound in chemical synthesis. Known for its stability and reactivity, it is commonly used as an intermediate in various industrial and research applications.

About

CAS No 3238-40-2
English Name 2,5-Furandicarboxylic acid
Molecular Formula C6H4O5
Molecular Weight 156.09 g/mol
SMILES C1=C(OC(=C1)C(=O)O)C(=O)O
InChIKey CHTHALBTIRVDBM-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2,5-Furandicarboxylic acid (CAS: 3238-40-2)?

2,5-Furandicarboxylic acid (CAS: 3238-40-2) is widely utilized in pharmaceuticals for drug developme...

Compound Q&A

Is 2,5-Furandicarboxylic acid (CAS: 3238-40-2) safe?

2,5-Furandicarboxylic acid (CAS: 3238-40-2) is generally considered safe when handled properly. Howe...

Compound Q&A

How should 2,5-Furandicarboxylic acid (CAS: 3238-40-2) be stored?

2,5-Furandicarboxylic acid (CAS: 3238-40-2) should be stored in a cool, dry place away from moisture...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...