Compound Q&A

How should 1-Octanesulfonic acid sodium salt (CAS: 5324-84-5) be stored?

Answer

1-Octanesulfonic acid sodium salt
1-Octanesulfonic acid sodium salt (CAS: 5324-84-5) should be stored in a cool, dry place away from direct light. It is stable under normal storage conditions but should be kept in a tightly sealed container to prevent moisture absorption. Proper storage ensures its effectiveness and safety in various applications.

About

CAS No 5324-84-5
English Name 1-Octanesulfonic acid sodium salt
Molecular Formula C8H17NaO3S
Molecular Weight 216.27 g/mol
SMILES CCCCCCCCS(=O)(=O)[O-].[Na+]
InChIKey HRQDCDQDOPSGBR-UHFFFAOYSA-M
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1-Octanesulfonic acid sodium salt (CAS: 5324-84-5)?

1-Octanesulfonic acid sodium salt (CAS: 5324-84-5) is a sodium salt of 1-octanesulfonic acid, which ...

Compound Q&A

What are the main uses of 1-Octanesulfonic acid sodium salt (CAS: 5324-84-5)?

1-Octanesulfonic acid sodium salt (CAS: 5324-84-5) is widely used in pharmaceuticals as a surfactant...

Compound Q&A

Is 1-Octanesulfonic acid sodium salt (CAS: 5324-84-5) safe?

1-Octanesulfonic acid sodium salt (CAS: 5324-84-5) is generally considered safe when used as directe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...