Compound Q&A

What is 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 7084-24-4)?

Answer

2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-glucopyranoside chloride
2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-glycoside chloride (CAS: 7084-24-4) is a complex organic compound containing a chromone ring functionalized with hydroxyl groups and a glucose sugar moiety. It is a chloride salt of a glycoside derivative, known for its antioxidant properties and potential role in bioactive research. The chemical formula is C15H14O9Cl, with molecular weight approximately 357.7 g/mol. It is typically a white solid with good solubility in polar solvents.

About

CAS No 7084-24-4
English Name 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-glucopyranoside chloride
Molecular Formula C21H21ClO11
Molecular Weight 484.8 g/mol
SMILES C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O.[Cl-]
InChIKey YTMNONATNXDQJF-UBNZBFALSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 7084-24-4)?

This compound is primarily used in pharmaceutical research for studying its antioxidant and anti-inf...

Compound Q&A

Is 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 7084-24-4) safe?

Safety data for this compound is limited, but as a chloride salt of a glycoside, it may pose risks u...

Compound Q&A

How should 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-glucopyranoside chloride (CAS: 7084-24-4) be stored?

Store this compound in a cool, dry, and dark place, preferably at 2-8°C, to maintain stability. Keep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...