Compound Q&A

What is 1,1-Cyclohexanediacetic Acid Monoamide (CAS: 99189-60-3)?

Answer

1,1-Cyclohexanediacetic Acid Monoamide
1,1-Cyclohexanediacetic Acid Monoamide, with the CAS number 99189-60-3, is a chemical compound used in various industrial and research applications. It has the molecular formula C8H15NO4 and is characterized by its amide functional group and cyclohexane ring structure. This compound is typically a white solid with moderate solubility in water and organic solvents, and it exhibits specific chemical reactivity due to its functional groups.

About

CAS No 99189-60-3
English Name 1,1-Cyclohexanediacetic Acid Monoamide
Molecular Formula C10H17NO3
Molecular Weight 199.25 g/mol
SMILES C1CCC(CC1)(CC(=O)N)CC(=O)O
InChIKey QJGSJXLCJRXTRY-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1,1-Cyclohexanediacetic Acid Monoamide (CAS: 99189-60-3)?

1,1-Cyclohexanediacetic Acid Monoamide (CAS: 99189-60-3) is primarily used in the pharmaceutical ind...

Compound Q&A

Is 1,1-Cyclohexanediacetic Acid Monoamide (CAS: 99189-60-3) safe?

1,1-Cyclohexanediacetic Acid Monoamide (CAS: 99189-60-3) is generally considered safe when handled p...

Compound Q&A

How should 1,1-Cyclohexanediacetic Acid Monoamide (CAS: 99189-60-3) be stored?

1,1-Cyclohexanediacetic Acid Monoamide (CAS: 99189-60-3) should be stored in a cool, dry, and well-v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...