Compound Q&A

What is Palmatine Chloride (CAS: 10605-02-4)?

Answer

Palmatine Chloride
Palmatine Chloride (CAS: 10605-02-4) is a synthetic alkaloid derivative of palmatine, a natural compound found in certain plants. It has the chemical formula C19H22ClNO2 and is known for its alkaline properties and solubility in water. This compound is commonly used in scientific research and pharmaceutical applications due to its biological activity.

About

CAS No 10605-02-4
English Name Palmatine Chloride
Molecular Formula C21H22ClNO4
Molecular Weight 387.9 g/mol
SMILES COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.[Cl-]
InChIKey RLQYRXCUPVKSAW-UHFFFAOYSA-M
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Palmatine Chloride (CAS: 10605-02-4)?

Palmatine Chloride (CAS: 10605-02-4) is primarily used in pharmaceutical research for its potential ...

Compound Q&A

Is Palmatine Chloride (CAS: 10605-02-4) safe?

Palmatine Chloride (CAS: 10605-02-4) is generally considered safe when handled properly, but it shou...

Compound Q&A

How should Palmatine Chloride (CAS: 10605-02-4) be stored?

Palmatine Chloride (CAS: 10605-02-4) should be stored in a cool, dry place away from direct light. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...