Compound Q&A

What are the main uses of 2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7)?

Answer

2-Phenyl-1H-benzimidazole-6-sulfonic acid
2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in the production of dyes, pigments, and other specialty chemicals. Additionally, it is studied for its potential role in materials science and as a precursor for functional molecules.

About

CAS No 27503-81-7
English Name 2-Phenyl-1H-benzimidazole-6-sulfonic acid
Molecular Formula C13H10N2O3S
Molecular Weight 274.3 g/mol
SMILES O=S(C1=CC=C2C(NC(C3=CC=CC=C3)=N2)=C1)(O)=O
InChIKey UVCJGUGAGLDPAA-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7)?

2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7) is an organic compound characterized by ...

Compound Q&A

Is 2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7) safe?

2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7) is generally considered safe when handle...

Compound Q&A

How should 2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7) be stored?

2-Phenyl-1H-benzimidazole-6-sulfonic acid (CAS: 27503-81-7) should be stored in a cool, dry, and dar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...