Compound Q&A

What are the main uses of 6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0)?

Answer

6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy-
6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0) is primarily used in pharmaceutical research as a key intermediate in the synthesis of various bioactive compounds. It also finds applications in organic chemistry for the development of new drugs and in the study of natural products. Its unique structure makes it valuable in medicinal chemistry for exploring its potential therapeutic effects.

About

CAS No 1143-70-0
English Name 6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy-
Molecular Formula C13H8O4
Molecular Weight 228.2 g/mol
SMILES C1=CC2=C(C=C1O)C(=O)OC3=C2C=CC(=C3)O
InChIKey RIUPLDUFZCXCHM-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0)?

6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0) is an organic compound characterized by ...

Compound Q&A

Is 6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0) safe?

6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0) is generally considered safe when handle...

Compound Q&A

How should 6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0) be stored?

6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (CAS: 1143-70-0) should be stored in a cool, dry, and dar...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...