Compound Q&A

How should 2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 590-63-6) be stored?

Answer

2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride
Store 2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 590-63-6) in a cool, dry place, away from direct light. Keep it in a sealed container to prevent moisture absorption and maintain stability. Avoid exposure to high temperatures or humidity, as these can affect its solubility and efficacy. Ensure storage in a well-ventilated area to comply with safety regulations for chemical handling.

About

CAS No 590-63-6
English Name 2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C7H17ClN2O2
Molecular Weight 196.67 g/mol
SMILES CC(C[N+](C)(C)C)OC(=O)N.[Cl-]
InChIKey XXRMYXBSBOVVBH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 590-63-6)?

2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 590-63-6) is a quaternary ammonium c...

Compound Q&A

What are the main uses of 2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 590-63-6)?

This compound is widely used in pharmaceuticals as a formulation aid, in industrial applications for...

Compound Q&A

Is 2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 590-63-6) safe?

2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 590-63-6) is generally considered sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...