Compound Q&A

What are the main uses of (2-Methyl-3-biphenylyl)methanol (CAS: 76350-90-8)?

Answer

(2-Methyl-3-biphenylyl)methanol
(2-Methyl-3-biphenylyl)methanol (CAS: 76350-90-8) is primarily used in pharmaceutical research and development. It serves as an intermediate in the synthesis of various drugs and chemical compounds. Additionally, it finds applications in organic chemistry for structural studies and in industrial processes requiring aromatic derivatives. Its unique molecular structure makes it valuable in the creation of new materials and functional chemicals.

About

CAS No 76350-90-8
English Name (2-Methyl-3-biphenylyl)methanol
Molecular Formula C14H14O
Molecular Weight 198.27 g/mol
SMILES CC1=C(C=CC=C1C2=CC=CC=C2)CO
InChIKey BGTLHJPGBIVQLJ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (2-Methyl-3-biphenylyl)methanol (CAS: 76350-90-8)?

(2-Methyl-3-biphenylyl)methanol is an organic compound with the CAS number 76350-90-8. It consists o...

Compound Q&A

Is (2-Methyl-3-biphenylyl)methanol (CAS: 76350-90-8) safe?

Safety of (2-Methyl-3-biphenylyl)methanol (CAS: 76350-90-8) depends on proper handling. It is genera...

Compound Q&A

How should (2-Methyl-3-biphenylyl)methanol (CAS: 76350-90-8) be stored?

(2-Methyl-3-biphenylyl)methanol (CAS: 76350-90-8) should be stored in a cool, dry, and well-ventilat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...