Compound Q&A

What are the main uses of 3-Hydroxy-2-naphthoic acid (CAS: 92-70-6)?

Answer

3-Hydroxy-2-naphthoic acid
3-Hydroxy-2-naphthoic acid (CAS: 92-70-6) is primarily utilized in pharmaceutical research for synthesizing drugs and bioactive compounds. It also serves as an industrial intermediate in the production of dyes, pesticides, and polymers. Additionally, it is employed in chemical studies to investigate metabolic pathways and functional group reactivity, owing to its structural versatility and availability.

About

CAS No 92-70-6
English Name 3-Hydroxy-2-naphthoic acid
Molecular Formula C11H8O3
Molecular Weight 188.18 g/mol
SMILES C1=CC=C2C=C(C(=CC2=C1)C(=O)O)O
InChIKey ALKYHXVLJMQRLQ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3-Hydroxy-2-naphthoic acid (CAS: 92-70-6)?

3-Hydroxy-2-naphthoic acid (CAS: 92-70-6) is a naphthalene derivative with the chemical formula C11H...

Compound Q&A

Is 3-Hydroxy-2-naphthoic acid (CAS: 92-70-6) safe?

3-Hydroxy-2-naphthoic acid (CAS: 92-70-6) is generally considered low to moderately toxic. It may ca...

Compound Q&A

How should 3-Hydroxy-2-naphthoic acid (CAS: 92-70-6) be stored?

3-Hydroxy-2-naphthoic acid (CAS: 92-70-6) should be stored in a cool, dry place, away from direct li...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...