Compound Q&A

What are the main uses of (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone (CAS: 461432-22-4)?

Answer

(5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone
This compound is primarily used in pharmaceutical research as a building block for drug development, particularly in creating molecules with antiviral or anti-inflammatory properties. It also finds applications in organic chemistry for synthesizing derivatives and in industrial processes requiring functionalized aromatic compounds. Its unique structure makes it suitable for targeted chemical modifications.

About

English Name (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone
Molecular Formula C15H12BrClO2
Molecular Weight 339.62 g/mol
SMILES CCOC1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Br)Cl
InChIKey OEURLNJEQCLGPS-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone (CAS: 461432-22-4)?

This organic compound, with the chemical formula C14H12BrClO2, is a methanone derivative featuring a...

Compound Q&A

Is (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone (CAS: 461432-22-4) safe?

Safety depends on proper handling. As a chemical with potential toxicity, it may cause skin or respi...

Compound Q&A

How should (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone (CAS: 461432-22-4) be stored?

Store in airtight, light-resistant containers at temperatures below 25°C in a cool, dry place. Maint...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...