Compound Q&A

What are the main uses of 3,7-Dimethyl-1,6-octadien-3-yl acetate (CAT: 115-95-7)?

Answer

3,7-Dimethyl-1,6-octadien-3-yl acetate
3,7-Dimethyl-1,6-octadien-3-yl acetate (CAS: 115-95-7) is primarily used in the fragrance and flavor industry due to its aromatic properties. It serves as a synthetic aroma compound in perfumes, cosmetics, and food products. Additionally, it is utilized in research for its chemical versatility and in pharmaceutical development as a component in certain drug formulations.

About

CAS No 115-95-7
English Name 3,7-Dimethyl-1,6-octadien-3-yl acetate
Molecular Formula C12H20O2
Molecular Weight 196.29 g/mol
SMILES CC(=CCCC(C)(OC(=O)C)C=C)C
InChIKey UWKAYLJWKGQEPM-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3,7-Dimethyl-1,6-octadien-3-yl acetate (CAT: 115-95-7)?

3,7-Dimethyl-1,6-octadien-3-yl acetate (CAS: 115-95-7) is a synthetic organic compound with the chem...

Compound Q&A

Is 3,7-Dimethyl-1,6-octadien-3-yl acetate (CAT: 115-95-7) safe?

3,7-Dimethyl-1,6-octadien-3-ylacetate (CAS: 115-95-7) is generally considered safe when used in acco...

Compound Q&A

How should 3,7-Dimethyl-1,6-octadien-3-yl acetate (CAT: 115-95-7) be stored?

3,7-Dimethyl-1,6-octadien-3-yl acetate (CAS: 115-95-7) should be stored in a cool, dry, and well-ven...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...