Compound Q&A

What are the main uses of 2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3)?

Answer

2-Hydroxy-5-sulfobenzoic acid dihydrate
2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3) is widely used in pharmaceuticals, such as in the formulation of metal chelators and as a precursor for certain drugs. It also finds applications in the dye industry, as a component in buffer solutions, and in research for its ability to interact with metal ions. Additionally, it is used in food processing and as a stabilizer in some cosmetic products.

About

CAS No 5965-83-3
English Name 2-Hydroxy-5-sulfobenzoic acid dihydrate
Molecular Formula C7H10O8S
Molecular Weight 254.22 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)O.O.O
InChIKey BHDKTFQBRFWJKR-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3)?

2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3) is a chemical compound commonly used in var...

Compound Q&A

Is 2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3) safe?

2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3) is generally considered safe when handled p...

Compound Q&A

How should 2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3) be stored?

2-Hydroxy-5-sulfobenzoic acid dihydrate (CAS: 5965-83-3) should be stored in a cool, dry place away ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...