Compound Q&A

What is (11-Oxo-6,11-dihydrodibenzo[b,e]oxepin-2-yl)acetic acid (CAS: 55453-87-7)?

Answer

(11-Oxo-6,11-dihydrodibenzo[b,e]oxepin-2-yl)acetic acid
This compound, with the CAS number 55453-87-7, is a complex organic molecule featuring a dibenzo[b,e]oxepin core with an acetic acid group attached at the 2-yl position. Its chemical formula is C16H12O3, and it is typically a yellow solid with low solubility in water but moderate solubility in organic solvents. The compound exhibits stability under standard conditions but requires careful handling due to its potential reactivity.

About

CAS No 55453-87-7
English Name (11-Oxo-6,11-dihydrodibenzo[b,e]oxepin-2-yl)acetic acid
Molecular Formula C16H12O4
Molecular Weight 268.27 g/mol
SMILES C1C2=CC=CC=C2C(=O)C3=C(O1)C=CC(=C3)CC(=O)O
InChIKey QFGMXJOBTNZHEL-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (11-Oxo-6,11-dihydrodibenzo[b,e]oxepin-2-yl)acetic acid (CAS: 55453-87-7)?

This compound is primarily used in pharmaceutical research as a potential lead molecule for drug dev...

Compound Q&A

Is (11-Oxo-6,11-dihydrodibenzo[b,e]oxepin-2-yl)acetic acid (CAS: 55453-87-7) safe?

Safety data for this compound is limited, but general precautions apply. It should be handled with c...

Compound Q&A

How should (11-Oxo-6,11-dihydrodibenzo[b,e]oxepin-2-yl)acetic acid (CAS: 55453-87-7) be stored?

This compound should be stored in a sealed, light-resistant container in a cool, dry place at temper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...