Compound Q&A

What is Amino(2-chlorophenyl)acetic acid (CAS: 141196-64-7)?

Answer

Amino(2-chlorophenyl)acetic acid
Amino(2-chlorophenyl)acetic acid is a chemical compound with the CAS number 141196-64-7. It has the molecular formula C8H9ClNO2 and is characterized by its amino and carboxylic acid functional groups attached to a 2-chlorophenyl ring. This compound is known for its ability to participate in various chemical reactions, making it relevant in synthetic chemistry and pharmaceutical research.

About

English Name Amino(2-chlorophenyl)acetic acid
Molecular Formula C8H8ClNO2
Molecular Weight 185.61 g/mol
SMILES C1=CC=C(C(=C1)C(C(=O)O)N)Cl
InChIKey LMIZLNPFTRQPSF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Amino(2-chlorophenyl)acetic acid (CAS: 141196-64-7)?

Amino(2-chlorophenyl)acetic acid is primarily used in pharmaceutical research as a building block fo...

Compound Q&A

Is Amino(2-chlorophenyl)acetic acid (CAS: 141196-64-7) safe?

Amino(2-chlorophenyl)acetic acid should be handled with care due to its potential toxicity. Protecti...

Compound Q&A

How should Amino(2-chlorophenyl)acetic acid (CAS: 141196-64-7) be stored?

Amino(2-chlorophenyl)acetic acid should be stored in a cool, dry place away from light. It is typica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...