Compound Q&A

What are the main uses of 5-Nitro-1H-indole (CAS: 6146-52-7)?

Answer

5-Nitro-1H-indole
5-Nitro-1H-indole (CAS: 6146-52-7) is primarily used in pharmaceutical research as a building block for synthesizing various bioactive compounds. It also finds applications in the production of dyes, pesticides, and other industrial chemicals. Its unique chemical structure makes it valuable in the development of drugs targeting specific biological pathways and in organic synthesis processes.

About

CAS No 6146-52-7
English Name 5-Nitro-1H-indole
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC2=C(C=CN2)C=C1[N+](=O)[O-]
InChIKey OZFPSOBLQZPIAV-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 5-Nitro-1H-indole (CAS: 6146-52-7)?

5-Nitro-1H-indole (CAS: 6146-52-7) is a heterocyclic aromatic compound belonging to the indole famil...

Compound Q&A

Is 5-Nitro-1H-indole (CAS: 6146-52-7) safe?

5-Nitro-1H-indole (CAS: 6146-52-7) is considered hazardous and requires careful handling. It may cau...

Compound Q&A

How should 5-Nitro-1H-indole (CAS: 6146-52-7) be stored?

5-Nitro-1H-indole (CAS: 6146-52-7) should be stored in a cool, dry, and dark place, away from moistu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...