Compound Q&A

What is [4-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99768-12-4)?

Answer

[4-(Methoxycarbonyl)phenyl]boronic acid
[4-(Methoxycarbonyl)phenyl]boronic acid, with CAS number 99768-12-4, is an organic compound containing a boronic acid functional group attached to a phenyl ring. It has the chemical formula C10H11BO3O2 and is known for its reactivity in chemical synthesis. The compound is often used as a building block in pharmaceutical and materials science applications due to its ability to participate in various reactions such as Suzuki coupling.

About

CAS No 99768-12-4
English Name [4-(Methoxycarbonyl)phenyl]boronic acid
Molecular Formula C8H9BO4
Molecular Weight 179.97 g/mol
SMILES B(C1=CC=C(C=C1)C(=O)OC)(O)O
InChIKey PQCXFUXRTRESBD-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of [4-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99768-12-4)?

[4-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99768-12-4) is primarily used in pharmaceutical resear...

Compound Q&A

Is [4-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99768-12-4) safe?

[4-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99768-12-4) is generally considered safe when handled ...

Compound Q&A

How should [4-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99768-12-4) be stored?

[4-(Methoxycarbonyl)phenyl]boronic acid (CAS: 99768-12-4) should be stored in a cool, dry place away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...