Compound Q&A

What is 3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6)?

Answer

3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid
3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6) is an organic compound containing a boronic acid group and a substituted phenyl ring. It is characterized by its difluoro substituents and a pyrrolidinylcarbonyl group attached to the aromatic ring. This compound is commonly used in chemical research for its potential in catalytic and synthetic applications due to its unique reactivity and structural features.

About

CAS No 9010-66-6
English Name 3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid
Molecular Formula C7H7FO2S
Molecular Weight 174.2 g/mol
SMILES B(C1=CC(=C(C(=C1)F)C(=O)N2CCCC2)F)(O)O
InChIKey YBYRMVIVWMBXKQ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6)?

3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6) is primarily used in phar...

Compound Q&A

Is 3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6) safe?

3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6) is generally considered s...

Compound Q&A

How should 3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6) be stored?

3,5-Difluoro-4-(1-pyrrolidinylcarbonyl)phenylboronic acid (CAS: 9010-66-6) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...