Compound Q&A

How should 9H-Fluoren-9-ylmethyl carbamate (CAS: 84418-43-9) be stored?

Answer

9H-Fluoren-9-ylmethyl carbamate
9H-Fluoren-9-ylmethyl carbamate should be stored in a cool, dry, and well-ventilated place, away from light and moisture. It is typically kept in a sealed container at a temperature below 25°C to maintain stability. Proper storage helps prevent degradation and ensures the compound remains effective for its intended use.

About

CAS No 84418-43-9
English Name 9H-Fluoren-9-ylmethyl carbamate
Molecular Formula C15H13NO2
Molecular Weight 239.27 g/mol
SMILES NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12
InChIKey ZZOKVYOCRSMTSS-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 9H-Fluoren-9-ylmethyl carbamate (CAS: 84418-43-9)?

9H-Fluoren-9-ylmethyl carbamate is a chemical compound with the CAS number 84418-43-9. It belongs to...

Compound Q&A

What are the main uses of 9H-Fluoren-9-ylmethyl carbamate (CAS: 84418-43-9)?

9H-Fluoren-9-ylmethyl carbamate is primarily used in pharmaceutical research as a building block for...

Compound Q&A

Is 9H-Fluoren-9-ylmethyl carbamate (CAS: 84418-43-9) safe?

9H-Fluoren-9-ylmethyl carbamate is generally considered safe when handled properly. However, standar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...