Compound Q&A

What is [4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4)?

Answer

[4-(Trifluoromethyl)phenyl]boronic acid
[4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4) is a boronic acid derivative with the chemical formula C8H8BF3O2. It features a phenyl ring substituted with a trifluoromethyl group at the 4-position, making it highly hydrophobic and reactive in organic synthesis. This compound is commonly used as an intermediate in the development of pharmaceuticals and materials science applications due to its functional group versatility.

About

English Name [4-(Trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H6BF3O2
Molecular Weight 189.93 g/mol
SMILES B(C1=CC=C(C=C1)C(F)(F)F)(O)O
InChIKey ALMFIOZYDASRRC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of [4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4)?

[4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4) is primarily utilized in pharmaceutical r...

Compound Q&A

Is [4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4) safe?

[4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4) is generally considered low toxicity but ...

Compound Q&A

How should [4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4) be stored?

[4-(Trifluoromethyl)phenyl]boronic acid (CAS: 128796-39-4) should be stored in a cool, dry place (2-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...