Compound Q&A

What is Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate (CAS: 168828-81-7)?

Answer

Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate
Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate is a chemical compound with the CAS number 168828-81-7. It belongs to the class of carbamates and is characterized by its structure containing a benzyl group, a fluoro-substituted phenyl ring, and a morpholinyl moiety. This compound is known for its pharmaceutical relevance due to its potential as an inhibitor of certain enzymes involved in biological processes.

About

English Name Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate
Molecular Formula C18H19FN2O3
Molecular Weight 330.4 g/mol
SMILES C1COCCN1C2=C(C=C(C=C2)NC(=O)OCC3=CC=CC=C3)F
InChIKey XKGUZGHMWUIYDR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate (CAS: 168828-81-7)?

Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate is primarily used in pharmaceutical research as a...

Compound Q&A

Is Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate (CAS: 168828-81-7) safe?

Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate is generally considered safe when handled properl...

Compound Q&A

How should Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate (CAS: 168828-81-7) be stored?

Benzyl [3-fluoro-4-(4-morpholinyl)phenyl]carbamate should be stored in a cool, dry, and well-ventila...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...