Compound Q&A

What are the main uses of 2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene (CAS: 29091-09-6)?

Answer

2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene
2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene is primarily used in the synthesis of pharmaceuticals and agrochemicals due to its versatile functional groups. It also serves as an intermediate in the production of dyes and other specialty chemicals. Its unique chemical structure makes it valuable in research for developing new compounds with specific reactivity and stability profiles.

About

CAS No 29091-09-6
English Name 2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene
Molecular Formula C7HCl2F3N2O4
Molecular Weight 304.99 g/mol
SMILES C1=C(C(=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])Cl)C(F)(F)F
InChIKey DPQYRXNRGNLPFC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene (CAS: 29091-09-6)?

2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene is an organic compound with the CAS number 29091...

Compound Q&A

Is 2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene (CAS: 29091-09-6) safe?

2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene is considered hazardous due to its potential tox...

Compound Q&A

How should 2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene (CAS: 29091-09-6) be stored?

2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene should be stored in a cool, dry, and dark place ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...