Compound Q&A

What is 2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8)?

Answer

2,2'-Bipyridine-5,5'-dicarboxylic acid
2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8) is a organic compound with the chemical formula C12H8N2O4. It features two pyridine rings connected by a methylene bridge, with carboxylic acid groups at the 5,5' positions. This compound is known for its stability and potential applications in coordination chemistry, acting as a ligand for metal complexes. Its molecular structure makes it valuable in various scientific fields.

About

CAS No 1802-30-8
English Name 2,2'-Bipyridine-5,5'-dicarboxylic acid
Molecular Formula C12H8N2O4
Molecular Weight 244.21 g/mol
SMILES C1=CC(=NC=C1C(=O)O)C2=NC=C(C=C2)C(=O)O
InChIKey KVQMUHHSWICEIH-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8)?

2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8) is primarily used in pharmaceutical research...

Compound Q&A

Is 2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8) safe?

2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8) is generally considered safe when handled pr...

Compound Q&A

How should 2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8) be stored?

2,2'-Bipyridine-5,5'-dicarboxylic acid (CAS: 1802-30-8) should be stored in a cool, dry place, away ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...