Compound Q&A

What are the main uses of Methyl protodioscin (CAS: 54522-52-0)?

Answer

Methyl protodioscin
Methyl protodioscin (CAS: 54522-52-0) is primarily used in pharmaceutical research for its potential therapeutic applications, such as anti-cancer and anti-arthritic effects. It also serves as a precursor in the synthesis of other bioactive compounds. In the industry, it is utilized in the development of natural products and medicinal chemicals. Its unique structure makes it valuable for studying saponin-based therapies and their mechanisms.

About

CAS No 54522-52-0
English Name Methyl protodioscin
Molecular Formula C52H86O22
Molecular Weight 1063.2 g/mol
SMILES CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC
InChIKey HSSJYSJXBOCKQM-GVTGEURHSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Methyl protodioscin (CAS: 54522-52-0)?

Methyl protodioscin (CAS: 54522-52-0) is a steroidal saponin compound derived from the plant Dipsacu...

Compound Q&A

Is Methyl protodioscin (CAS: 54522-52-0) safe?

Methyl protodioscin (CAS: 54522-52-0) is generally considered safe when handled properly, but its to...

Compound Q&A

How should Methyl protodioscin (CAS: 54522-52-0) be stored?

Methyl protodioscin (CAS: 54522-52-0) should be stored in a cool, dry place, preferably at 2-8°C, in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...