Compound Q&A

What are the main uses of (5beta,20R)-3,7,12-Trioxocholan-24-oic acid (CAS: 81-23-2)?

Answer

(5beta,20R)-3,7,12-Trioxocholan-24-oic acid
(5beta,20R)-3,7,12-Trioxocholan-24-oic acid (CAS: 81-23-2) is primarily used in pharmaceutical research for its potential role in metabolic disorders and liver function studies. It also serves as a synthetic intermediate in the development of bile acid analogs and is utilized in biochemical research for studying lipid metabolism and bile acid synthesis pathways.

About

CAS No 81-23-2
English Name (5beta,20R)-3,7,12-Trioxocholan-24-oic acid
Molecular Formula C24H34O5
Molecular Weight 402.53 g/mol
SMILES C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC(=O)[C@]12C)[C@@]4(C)CCC(=O)C[C@H]4CC3=O
InChIKey OHXPGWPVLFPUSM-KLRNGDHRSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (5beta,20R)-3,7,12-Trioxocholan-24-oic acid (CAS: 81-23-2)?

(5beta,20R)-3,7,12-Trioxocholan-24-oic acid, with the CAS number 81-23-2, is a type of bile acid der...

Compound Q&A

Is (5beta,20R)-3,7,12-Trioxocholan-24-oic acid (CAS: 81-23-2) safe?

(5beta,20R)-3,7,12-Trioxocholan-24-oic acid (CAS: 81-23-2) is generally considered safe when handled...

Compound Q&A

How should (5beta,20R)-3,7,12-Trioxocholan-24-oic acid (CAS: 81-23-2) be stored?

(5beta,20R)-3,7,12-Trioxocholan-24-oic acid (CAS: 81-23-2) should be stored in a cool, dry, and dark...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...