Compound Q&A

What is L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4)?

Answer

L-Arginine Ethyl Ester Dihydrochloride
L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4) is a chemical compound commonly used as a precursor in the synthesis of L-arginine. It is a salt form of L-arginine ethyl ester, which is known for its stability and solubility in water. The compound has a molecular formula of C6H14N4O2Cl2 and is typically used in pharmaceutical and research applications due to its ability to release L-arginine in the body.

About

CAS No 36589-29-4
English Name L-Arginine Ethyl Ester Dihydrochloride
Molecular Formula C8H20Cl2N4O2
Molecular Weight 275.18 g/mol
SMILES CCOC(=O)C(CCCN=C(N)N)N.Cl.Cl
InChIKey RPFXMGGIQREZOH-ILKKLZGPSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4)?

L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4) is primarily used in the pharmaceutical ind...

Compound Q&A

Is L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4) safe?

L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4) is generally considered safe when used in a...

Compound Q&A

How should L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4) be stored?

L-Arginine Ethyl Ester Dihydrochloride (CAS: 36589-29-4) should be stored in a cool, dry, and well-v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...