Compound Q&A

What is N,N,N-Tributyl-1-butanaminium acetate (CAS: 10534-59-5)?

Answer

N,N,N-Tributyl-1-butanaminium acetate
N,N,N-Tributyl-1-butanaminium acetate is an organic compound with the CAS number 10534-59-5. It is a quaternary ammonium salt characterized by a positively charged nitrogen atom bonded to three butyl groups and an acetate ion. This compound is commonly used in various chemical applications due to its unique structure and properties.

About

CAS No 10534-59-5
English Name N,N,N-Tributyl-1-butanaminium acetate
Molecular Formula C18H39NO2
Molecular Weight 301.5 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.CC(=O)[O-]
InChIKey MCZDHTKJGDCTAE-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium acetate (CAS: 10534-59-5)?

N,N,N-Tributyl-1-butanaminium acetate is primarily used in pharmaceuticals as a surfactant or emulsi...

Compound Q&A

Is N,N,N-Tributyl-1-butanaminium acetate (CAS: 10534-59-5) safe?

N,N,N-Tributyl-1-butanaminium acetate is generally considered safe when handled properly. However, a...

Compound Q&A

How should N,N,N-Tributyl-1-butanaminium acetate (CAS: 10534-59-5) be stored?

N,N,N-Tributyl-1-butanaminium acetate should be stored in a cool, dry, and well-ventilated area away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...