Compound Q&A

What are the main uses of Tetrabutylphosphonium bromide (CAS: 3115-68-2)?

Answer

Tetrabutylphosphonium bromide
Tetrabutylphosphonium bromide is widely used as a phase transfer catalyst in pharmaceuticals, organic chemistry, and industrial applications. It facilitates reactions between aqueous and organic phases, aiding in the synthesis of complex molecules. Additionally, it serves as a reagent in polymerization processes and is employed in research for developing new chemical methodologies. Its versatility makes it a key compound in catalytic and synthetic chemistry.

About

CAS No 3115-68-2
English Name Tetrabutylphosphonium bromide
Molecular Formula C16H36BrP
Molecular Weight 339.33 g/mol
SMILES CCCC[P+](CCCC)(CCCC)CCCC.[Br-]
InChIKey RKHXQBLJXBGEKF-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Tetrabutylphosphonium bromide (CAS: 3115-68-2)?

Tetrabutylphosphonium bromide is a quaternary phosphonium compound with the chemical formula (C4H9)4...

Compound Q&A

Is Tetrabutylphosphonium bromide (CAS: 3115-68-2) safe?

Tetrabutylphosphonium bromide is generally considered safe when handled properly, but it may cause s...

Compound Q&A

How should Tetrabutylphosphonium bromide (CAS: 3115-68-2) be stored?

Tetrabutylphosphonium bromide should be stored in a cool, dry place, preferably below 25°C, to maint...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...