Compound Q&A

What is 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8)?

Answer

4,4'-Methylenebis(3-hydroxy-2-naphthoic acid)
4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8) is a synthetic organic compound with the chemical formula C20H14O6. It is a white solid with hydroxy and carboxylic acid groups, known for its thermal stability and reactivity in chemical synthesis. This compound serves as a key intermediate in the production of various pharmaceuticals and industrial materials due to its versatile functional groups.

About

CAS No 130-85-8
English Name 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid)
Molecular Formula C23H16O6
Molecular Weight 388.38 g/mol
SMILES C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)O)O)C(=O)O
InChIKey WLJNZVDCPSBLRP-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8)?

4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8) is primarily used in pharmaceuticals a...

Compound Q&A

Is 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8) safe?

4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8) is generally considered safe when hand...

Compound Q&A

How should 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8) be stored?

4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) (CAS: 130-85-8) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...